C9H20N4O — CID 43252657
2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]acetamide (PubChem CID 43252657) has the molecular formula C9H20N4O and a molecular weight of 200.29 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]acetamide.
| Compound Name | 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 43252657 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-[4-(2-aminoethyl)-1,4-diazepan-1-yl]acetamide |
| SMILES | NCCN1CCCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C9H20N4O/c10-2-5-12-3-1-4-13(7-6-12)8-9(11)14/h1-8,10H2,(H2,11,14) |
| InChIKey | XKKJFYLBKURAQX-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |