C8H16ClN3O3S — CID 63666188
2-[4-(chloromethylsulfonyl)-1,4-diazepan-1-yl]acetamide (PubChem CID 63666188) has the molecular formula C8H16ClN3O3S and a molecular weight of 269.75 g/mol. Its IUPAC name is 2-[4-(chloromethylsulfonyl)-1,4-diazepan-1-yl]acetamide.
| Compound Name | 2-[4-(chloromethylsulfonyl)-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 63666188 |
| Molecular Formula | C8H16ClN3O3S |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-[4-(chloromethylsulfonyl)-1,4-diazepan-1-yl]acetamide |
| SMILES | NC(=O)CN1CCCN(S(=O)(=O)CCl)CC1 |
| InChI | InChI=1S/C8H16ClN3O3S/c9-7-16(14,15)12-3-1-2-11(4-5-12)6-8(10)13/h1-7H2,(H2,10,13) |
| InChIKey | VYQWPCLIEUROEC-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|