C11H18N4O3S2 — CID 61298632
2-[4-(4-aminothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetamide (PubChem CID 61298632) has the molecular formula C11H18N4O3S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[4-(4-aminothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetamide.
| Compound Name | 2-[4-(4-aminothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 61298632 |
| Molecular Formula | C11H18N4O3S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[4-(4-aminothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]acetamide |
| SMILES | NC(=O)CN1CCCN(S(=O)(=O)c2cc(N)cs2)CC1 |
| InChI | InChI=1S/C11H18N4O3S2/c12-9-6-11(19-8-9)20(17,18)15-3-1-2-14(4-5-15)7-10(13)16/h6,8H,1-5,7,12H2,(H2,13,16) |
| InChIKey | LUMKLBPLCJQZEK-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |