C11H18N4O3S2 — CID 61300187
[1-(4-aminothiophen-2-yl)sulfonylpiperidin-3-yl]methylurea (PubChem CID 61300187) has the molecular formula C11H18N4O3S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is [1-(4-aminothiophen-2-yl)sulfonylpiperidin-3-yl]methylurea.
| Compound Name | [1-(4-aminothiophen-2-yl)sulfonylpiperidin-3-yl]methylurea |
|---|---|
| PubChem CID | 61300187 |
| Molecular Formula | C11H18N4O3S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [1-(4-aminothiophen-2-yl)sulfonylpiperidin-3-yl]methylurea |
| SMILES | NC(=O)NCC1CCCN(S(=O)(=O)c2cc(N)cs2)C1 |
| InChI | InChI=1S/C11H18N4O3S2/c12-9-4-10(19-7-9)20(17,18)15-3-1-2-8(6-15)5-14-11(13)16/h4,7-8H,1-3,5-6,12H2,(H3,13,14,16) |
| InChIKey | FVXOZIWTZXHDAW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |