C16H20N2O4S2 — CID 42355799
N-[[(3S)-1-(4-methylthiophen-2-yl)sulfonylpiperidin-3-yl]methyl]furan-2-carboxamide (PubChem CID 42355799) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[[(3S)-1-(4-methylthiophen-2-yl)sulfonylpiperidin-3-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[(3S)-1-(4-methylthiophen-2-yl)sulfonylpiperidin-3-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42355799 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[[(3S)-1-(4-methylthiophen-2-yl)sulfonylpiperidin-3-yl]methyl]furan-2-carboxamide |
| SMILES | Cc1csc(S(=O)(=O)N2CCC[C@@H](CNC(=O)c3ccco3)C2)c1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-12-8-15(23-11-12)24(20,21)18-6-2-4-13(10-18)9-17-16(19)14-5-3-7-22-14/h3,5,7-8,11,13H,2,4,6,9-10H2,1H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | SDOSZJJZHKSFLY-ZDUSSCGKSA-N |
| XLogP | 2.48 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |