C16H20N2O2S — CID 25450902
N-[[(3R)-1-(thiophen-3-ylmethyl)piperidin-3-yl]methyl]furan-2-carboxamide (PubChem CID 25450902) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is N-[[(3R)-1-(thiophen-3-ylmethyl)piperidin-3-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[(3R)-1-(thiophen-3-ylmethyl)piperidin-3-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25450902 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[[(3R)-1-(thiophen-3-ylmethyl)piperidin-3-yl]methyl]furan-2-carboxamide |
| SMILES | O=C(NC[C@H]1CCCN(Cc2ccsc2)C1)c1ccco1 |
| InChI | InChI=1S/C16H20N2O2S/c19-16(15-4-2-7-20-15)17-9-13-3-1-6-18(10-13)11-14-5-8-21-12-14/h2,4-5,7-8,12-13H,1,3,6,9-11H2,(H,17,19)/t13-/m1/s1 |
| InChIKey | FFSVSTJJXVQUNU-CYBMUJFWSA-N |
| XLogP | 2.98 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |