C18H22N2O3S — CID 124780598
N-[[(1R,3aR,7aR)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]furan-2-carboxamide (PubChem CID 124780598) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N-[[(1R,3aR,7aR)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[(1R,3aR,7aR)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 124780598 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[[(1R,3aR,7aR)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]furan-2-carboxamide |
| SMILES | O=C(NC[C@@H]1OC[C@H]2CN(Cc3ccsc3)CC[C@H]21)c1ccco1 |
| InChI | InChI=1S/C18H22N2O3S/c21-18(16-2-1-6-22-16)19-8-17-15-3-5-20(10-14(15)11-23-17)9-13-4-7-24-12-13/h1-2,4,6-7,12,14-15,17H,3,5,8-11H2,(H,19,21)/t14-,15-,17+/m1/s1 |
| InChIKey | NKTLFCKGBVIICB-INMHGKMJSA-N |
| XLogP | 2.61 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |