C14H22N2O3S2 — CID 124782364
N-[[(1R,3aS,7aS)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]methanesulfonamide (PubChem CID 124782364) has the molecular formula C14H22N2O3S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is N-[[(1R,3aS,7aS)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(1R,3aS,7aS)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 124782364 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N-[[(1R,3aS,7aS)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@@H]1OC[C@@H]2CN(Cc3ccsc3)CC[C@@H]21 |
| InChI | InChI=1S/C14H22N2O3S2/c1-21(17,18)15-6-14-13-2-4-16(8-12(13)9-19-14)7-11-3-5-20-10-11/h3,5,10,12-15H,2,4,6-9H2,1H3/t12-,13-,14-/m0/s1 |
| InChIKey | GOMOUKKINMGXSZ-IHRRRGAJSA-N |
| XLogP | 1.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |