C14H20N2O4S2 — CID 98777316
N-[[(1R,3aR,7aR)-5-(thiophene-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]methanesulfonamide (PubChem CID 98777316) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[[(1R,3aR,7aR)-5-(thiophene-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(1R,3aR,7aR)-5-(thiophene-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 98777316 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-[[(1R,3aR,7aR)-5-(thiophene-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@@H]1OC[C@H]2CN(C(=O)c3cccs3)CC[C@H]21 |
| InChI | InChI=1S/C14H20N2O4S2/c1-22(18,19)15-7-12-11-4-5-16(8-10(11)9-20-12)14(17)13-3-2-6-21-13/h2-3,6,10-12,15H,4-5,7-9H2,1H3/t10-,11-,12+/m1/s1 |
| InChIKey | XMUAALWZTFHUCX-UTUOFQBUSA-N |
| XLogP | 0.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |