C15H22N4O5S — CID 131689629
N-[[(3S,3aR,7aR)-5-(3-acetyl-1H-pyrazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide (PubChem CID 131689629) has the molecular formula C15H22N4O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[[(3S,3aR,7aR)-5-(3-acetyl-1H-pyrazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3S,3aR,7aR)-5-(3-acetyl-1H-pyrazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 131689629 |
| Molecular Formula | C15H22N4O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[[(3S,3aR,7aR)-5-(3-acetyl-1H-pyrazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide |
| SMILES | CC(=O)c1cc(C(=O)N2CC[C@H]3CO[C@H](CNS(C)(=O)=O)[C@H]3C2)[nH]n1 |
| InChI | InChI=1S/C15H22N4O5S/c1-9(20)12-5-13(18-17-12)15(21)19-4-3-10-8-24-14(11(10)7-19)6-16-25(2,22)23/h5,10-11,14,16H,3-4,6-8H2,1-2H3,(H,17,18)/t10-,11-,14+/m0/s1 |
| InChIKey | WOCOOZVWQJQLHI-COPLHBTASA-N |
| XLogP | -0.36 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |