C15H19F2N3O4S — CID 131689145
N-[[(3S,3aR,7aR)-5-(2,5-difluoropyridine-4-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide (PubChem CID 131689145) has the molecular formula C15H19F2N3O4S and a molecular weight of 375.40 g/mol. Its IUPAC name is N-[[(3S,3aR,7aR)-5-(2,5-difluoropyridine-4-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3S,3aR,7aR)-5-(2,5-difluoropyridine-4-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 131689145 |
| Molecular Formula | C15H19F2N3O4S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[[(3S,3aR,7aR)-5-(2,5-difluoropyridine-4-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@H]1OC[C@@H]2CCN(C(=O)c3cc(F)ncc3F)C[C@@H]21 |
| InChI | InChI=1S/C15H19F2N3O4S/c1-25(22,23)19-6-13-11-7-20(3-2-9(11)8-24-13)15(21)10-4-14(17)18-5-12(10)16/h4-5,9,11,13,19H,2-3,6-8H2,1H3/t9-,11-,13+/m0/s1 |
| InChIKey | USWTZOGKYUFJHM-XHVZSJERSA-N |
| XLogP | 0.39 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|