C17H21F2N3O2 — CID 131691576
[(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(2,5-difluoro-4-pyridinyl)methanone (PubChem CID 131691576) has the molecular formula C17H21F2N3O2 and a molecular weight of 337.37 g/mol. Its IUPAC name is [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(2,5-difluoro-4-pyridinyl)methanone.
| Compound Name | [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(2,5-difluoro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 131691576 |
| Molecular Formula | C17H21F2N3O2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(2,5-difluoro-4-pyridinyl)methanone |
| SMILES | O=C(c1cc(F)ncc1F)N1C[C@@H]2CN(CC3CC3)CCO[C@@H]2C1 |
| InChI | InChI=1S/C17H21F2N3O2/c18-14-6-20-16(19)5-13(14)17(23)22-9-12-8-21(7-11-1-2-11)3-4-24-15(12)10-22/h5-6,11-12,15H,1-4,7-10H2/t12-,15+/m0/s1 |
| InChIKey | SFVXRIHAQXFCOD-SWLSCSKDSA-N |
| XLogP | 1.54 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|