C21H27N3O2 — CID 131691496
[(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(1-methylindol-2-yl)methanone (PubChem CID 131691496) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(1-methylindol-2-yl)methanone.
| Compound Name | [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(1-methylindol-2-yl)methanone |
|---|---|
| PubChem CID | 131691496 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(1-methylindol-2-yl)methanone |
| SMILES | Cn1c(C(=O)N2C[C@@H]3CN(CC4CC4)CCO[C@@H]3C2)cc2ccccc21 |
| InChI | InChI=1S/C21H27N3O2/c1-22-18-5-3-2-4-16(18)10-19(22)21(25)24-13-17-12-23(11-15-6-7-15)8-9-26-20(17)14-24/h2-5,10,15,17,20H,6-9,11-14H2,1H3/t17-,20+/m0/s1 |
| InChIKey | LXAAGGOLXDGMLT-FXAWDEMLSA-N |
| XLogP | 2.36 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |