C18H22N2O2 — CID 94613444
[(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(1-methylindol-2-yl)methanone (PubChem CID 94613444) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is [(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(1-methylindol-2-yl)methanone.
| Compound Name | [(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(1-methylindol-2-yl)methanone |
|---|---|
| PubChem CID | 94613444 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [(4aR,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(1-methylindol-2-yl)methanone |
| SMILES | Cn1c(C(=O)N2CCO[C@H]3CCCC[C@H]32)cc2ccccc21 |
| InChI | InChI=1S/C18H22N2O2/c1-19-14-7-3-2-6-13(14)12-16(19)18(21)20-10-11-22-17-9-5-4-8-15(17)20/h2-3,6-7,12,15,17H,4-5,8-11H2,1H3/t15-,17+/m1/s1 |
| InChIKey | YZSPCGISDAEUIV-WBVHZDCISA-N |
| XLogP | 2.96 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |