C18H21N3O2 — CID 97016712
[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(3-phenylimidazol-4-yl)methanone (PubChem CID 97016712) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is [(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(3-phenylimidazol-4-yl)methanone.
| Compound Name | [(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(3-phenylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 97016712 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | [(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(3-phenylimidazol-4-yl)methanone |
| SMILES | O=C(c1cncn1-c1ccccc1)N1CCO[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C18H21N3O2/c22-18(20-10-11-23-17-9-5-4-8-15(17)20)16-12-19-13-21(16)14-6-2-1-3-7-14/h1-3,6-7,12-13,15,17H,4-5,8-11H2/t15-,17+/m0/s1 |
| InChIKey | WHWZNXODZYZVEL-DOTOQJQBSA-N |
| XLogP | 2.66 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |