C17H19N5O3 — CID 127266581
N'-acetyl-1-(3-phenylimidazole-4-carbonyl)pyrrolidine-2-carbohydrazide (PubChem CID 127266581) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is N'-acetyl-1-(3-phenylimidazole-4-carbonyl)pyrrolidine-2-carbohydrazide.
| Compound Name | N'-acetyl-1-(3-phenylimidazole-4-carbonyl)pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 127266581 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N'-acetyl-1-(3-phenylimidazole-4-carbonyl)pyrrolidine-2-carbohydrazide |
| SMILES | CC(=O)NNC(=O)C1CCCN1C(=O)c1cncn1-c1ccccc1 |
| InChI | InChI=1S/C17H19N5O3/c1-12(23)19-20-16(24)14-8-5-9-21(14)17(25)15-10-18-11-22(15)13-6-3-2-4-7-13/h2-4,6-7,10-11,14H,5,8-9H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | UIYMBSXEJHWAIN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|