C17H17N3O4 — CID 24658797
N'-benzoyl-1-(furan-2-carbonyl)pyrrolidine-2-carbohydrazide (PubChem CID 24658797) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is N'-benzoyl-1-(furan-2-carbonyl)pyrrolidine-2-carbohydrazide.
| Compound Name | N'-benzoyl-1-(furan-2-carbonyl)pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 24658797 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N'-benzoyl-1-(furan-2-carbonyl)pyrrolidine-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCN1C(=O)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O4/c21-15(12-6-2-1-3-7-12)18-19-16(22)13-8-4-10-20(13)17(23)14-9-5-11-24-14/h1-3,5-7,9,11,13H,4,8,10H2,(H,18,21)(H,19,22) |
| InChIKey | MCDHAGBBCZBLOR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|