C16H15IN2O3 — CID 71902260
1-(furan-2-carbonyl)-N-(3-iodophenyl)pyrrolidine-2-carboxamide (PubChem CID 71902260) has the molecular formula C16H15IN2O3 and a molecular weight of 410.21 g/mol. Its IUPAC name is 1-(furan-2-carbonyl)-N-(3-iodophenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(furan-2-carbonyl)-N-(3-iodophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71902260 |
| Molecular Formula | C16H15IN2O3 |
| Molecular Weight | 410.21 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 1-(furan-2-carbonyl)-N-(3-iodophenyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(I)c1)C1CCCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C16H15IN2O3/c17-11-4-1-5-12(10-11)18-15(20)13-6-2-8-19(13)16(21)14-7-3-9-22-14/h1,3-5,7,9-10,13H,2,6,8H2,(H,18,20) |
| InChIKey | WAKQBBXTTHKVKC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.21 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|