C17H19N3O3 — CID 96526953
(2S)-1-(furan-2-carbonyl)-N-(2-methyl-4-pyridinyl)piperidine-2-carboxamide (PubChem CID 96526953) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is (2S)-1-(furan-2-carbonyl)-N-(2-methyl-4-pyridinyl)piperidine-2-carboxamide.
| Compound Name | (2S)-1-(furan-2-carbonyl)-N-(2-methyl-4-pyridinyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 96526953 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (2S)-1-(furan-2-carbonyl)-N-(2-methyl-4-pyridinyl)piperidine-2-carboxamide |
| SMILES | Cc1cc(NC(=O)[C@@H]2CCCCN2C(=O)c2ccco2)ccn1 |
| InChI | InChI=1S/C17H19N3O3/c1-12-11-13(7-8-18-12)19-16(21)14-5-2-3-9-20(14)17(22)15-6-4-10-23-15/h4,6-8,10-11,14H,2-3,5,9H2,1H3,(H,18,19,21)/t14-/m0/s1 |
| InChIKey | YJUFIMCPHBTSSE-AWEZNQCLSA-N |
| XLogP | 2.62 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |