C20H22N2O5 — CID 99589299
methyl 2-[3-[[(2R)-1-(furan-2-carbonyl)piperidine-2-carbonyl]amino]phenyl]acetate (PubChem CID 99589299) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 2-[3-[[(2R)-1-(furan-2-carbonyl)piperidine-2-carbonyl]amino]phenyl]acetate.
| Compound Name | methyl 2-[3-[[(2R)-1-(furan-2-carbonyl)piperidine-2-carbonyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 99589299 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | methyl 2-[3-[[(2R)-1-(furan-2-carbonyl)piperidine-2-carbonyl]amino]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(NC(=O)[C@H]2CCCCN2C(=O)c2ccco2)c1 |
| InChI | InChI=1S/C20H22N2O5/c1-26-18(23)13-14-6-4-7-15(12-14)21-19(24)16-8-2-3-10-22(16)20(25)17-9-5-11-27-17/h4-7,9,11-12,16H,2-3,8,10,13H2,1H3,(H,21,24)/t16-/m1/s1 |
| InChIKey | ILTQBCWDMPSWOP-MRXNPFEDSA-N |
| XLogP | 2.63 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |