C17H18N2O4 — CID 50875716
1-(furan-2-carbonyl)-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 50875716) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 1-(furan-2-carbonyl)-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(furan-2-carbonyl)-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 50875716 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-(furan-2-carbonyl)-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN2C(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C17H18N2O4/c1-22-13-8-6-12(7-9-13)18-16(20)14-4-2-10-19(14)17(21)15-5-3-11-23-15/h3,5-9,11,14H,2,4,10H2,1H3,(H,18,20) |
| InChIKey | KJCCQLLFLMQWNF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |