C17H15F3N2O4 — CID 46420968
(2S)-1-(furan-2-carbonyl)-N-[4-(trifluoromethoxy)phenyl]pyrrolidine-2-carboxamide (PubChem CID 46420968) has the molecular formula C17H15F3N2O4 and a molecular weight of 368.31 g/mol. Its IUPAC name is (2S)-1-(furan-2-carbonyl)-N-[4-(trifluoromethoxy)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(furan-2-carbonyl)-N-[4-(trifluoromethoxy)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 46420968 |
| Molecular Formula | C17H15F3N2O4 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (2S)-1-(furan-2-carbonyl)-N-[4-(trifluoromethoxy)phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)[C@@H]1CCCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C17H15F3N2O4/c18-17(19,20)26-12-7-5-11(6-8-12)21-15(23)13-3-1-9-22(13)16(24)14-4-2-10-25-14/h2,4-8,10,13H,1,3,9H2,(H,21,23)/t13-/m0/s1 |
| InChIKey | LJPRZPHCEVQOEJ-ZDUSSCGKSA-N |
| XLogP | 3.42 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |