C21H24N2O5 — CID 24658807
butyl 4-[[1-(furan-2-carbonyl)pyrrolidine-2-carbonyl]amino]benzoate (PubChem CID 24658807) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is butyl 4-[[1-(furan-2-carbonyl)pyrrolidine-2-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[1-(furan-2-carbonyl)pyrrolidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 24658807 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | butyl 4-[[1-(furan-2-carbonyl)pyrrolidine-2-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C2CCCN2C(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C21H24N2O5/c1-2-3-13-28-21(26)15-8-10-16(11-9-15)22-19(24)17-6-4-12-23(17)20(25)18-7-5-14-27-18/h5,7-11,14,17H,2-4,6,12-13H2,1H3,(H,22,24) |
| InChIKey | VKUPWINHZZPFGX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|