C23H26N2O8 — CID 55944214
3-[(2S)-1-(furan-2-carbonyl)pyrrolidine-2-carbonyl]oxypropyl (2S)-1-(furan-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 55944214) has the molecular formula C23H26N2O8 and a molecular weight of 458.47 g/mol. Its IUPAC name is 3-[(2S)-1-(furan-2-carbonyl)pyrrolidine-2-carbonyl]oxypropyl (2S)-1-(furan-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | 3-[(2S)-1-(furan-2-carbonyl)pyrrolidine-2-carbonyl]oxypropyl (2S)-1-(furan-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55944214 |
| Molecular Formula | C23H26N2O8 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 3-[(2S)-1-(furan-2-carbonyl)pyrrolidine-2-carbonyl]oxypropyl (2S)-1-(furan-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCCCOC(=O)[C@@H]1CCCN1C(=O)c1ccco1)[C@@H]1CCCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C23H26N2O8/c26-20(18-8-3-12-30-18)24-10-1-6-16(24)22(28)32-14-5-15-33-23(29)17-7-2-11-25(17)21(27)19-9-4-13-31-19/h3-4,8-9,12-13,16-17H,1-2,5-7,10-11,14-15H2/t16-,17-/m0/s1 |
| InChIKey | QQUXSVSTPOUSHL-IRXDYDNUSA-N |
| XLogP | 2.26 |
| TPSA | 119.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|