C23H23NO5 — CID 60554533
(6-methoxynaphthalen-2-yl)methyl 1-(furan-2-carbonyl)piperidine-2-carboxylate (PubChem CID 60554533) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is (6-methoxynaphthalen-2-yl)methyl 1-(furan-2-carbonyl)piperidine-2-carboxylate.
| Compound Name | (6-methoxynaphthalen-2-yl)methyl 1-(furan-2-carbonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 60554533 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (6-methoxynaphthalen-2-yl)methyl 1-(furan-2-carbonyl)piperidine-2-carboxylate |
| SMILES | COc1ccc2cc(COC(=O)C3CCCCN3C(=O)c3ccco3)ccc2c1 |
| InChI | InChI=1S/C23H23NO5/c1-27-19-10-9-17-13-16(7-8-18(17)14-19)15-29-23(26)20-5-2-3-11-24(20)22(25)21-6-4-12-28-21/h4,6-10,12-14,20H,2-3,5,11,15H2,1H3 |
| InChIKey | DBSQFTCAFXGXQP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |