C22H25NO4 — CID 166373036
2-(3-methoxyphenyl)ethyl 1-benzoylpiperidine-2-carboxylate (PubChem CID 166373036) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)ethyl 1-benzoylpiperidine-2-carboxylate.
| Compound Name | 2-(3-methoxyphenyl)ethyl 1-benzoylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 166373036 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-(3-methoxyphenyl)ethyl 1-benzoylpiperidine-2-carboxylate |
| SMILES | COc1cccc(CCOC(=O)C2CCCCN2C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H25NO4/c1-26-19-11-7-8-17(16-19)13-15-27-22(25)20-12-5-6-14-23(20)21(24)18-9-3-2-4-10-18/h2-4,7-11,16,20H,5-6,12-15H2,1H3 |
| InChIKey | XTLRGVFMYBKAPC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |