C25H31NO6 — CID 44765789
2-(3,4-dimethoxyphenyl)ethyl 1-(2-ethoxybenzoyl)piperidine-2-carboxylate (PubChem CID 44765789) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl 1-(2-ethoxybenzoyl)piperidine-2-carboxylate.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl 1-(2-ethoxybenzoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 44765789 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl 1-(2-ethoxybenzoyl)piperidine-2-carboxylate |
| SMILES | CCOc1ccccc1C(=O)N1CCCCC1C(=O)OCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H31NO6/c1-4-31-21-11-6-5-9-19(21)24(27)26-15-8-7-10-20(26)25(28)32-16-14-18-12-13-22(29-2)23(17-18)30-3/h5-6,9,11-13,17,20H,4,7-8,10,14-16H2,1-3H3 |
| InChIKey | CEEDNQGNOQFRIR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |