About 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate
2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate (PubChem CID 44764644) has the molecular formula C28H30N2O6
and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate |
| PubChem CID | 44764644 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate |
| SMILES | COc1ccc(CCOC(=O)C2CCCCN2C(=O)c2cccnc2Oc2ccccc2)cc1OC |
| InChI | InChI=1S/C28H30N2O6/c1-33-24-14-13-20(19-25(24)34-2)15-18-35-28(32)23-12-6-7-17-30(23)27(31)22-11-8-16-29-26(22)36-21-9-4-3-5-10-21/h3-5,8-11,13-14,16,19,23H,6-7,12,15,17-18H2,1-2H3 |
| InChIKey | RSNDWZRGPOLVKX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate?
The IUPAC name of 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate (CID 44764644) is 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate is COc1ccc(CCOC(=O)C2CCCCN2C(=O)c2cccnc2Oc2ccccc2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate?
The InChIKey is RSNDWZRGPOLVKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N2O6/c1-33-24-14-13-20(19-25(24)34-2)15-18-35-28(32)23-12-6-7-17-30(23)27(31)22-11-8-16-29-26(22)36-21-9-4-3-5-10-21/h3-5,8-11,13-14,16,19,23H,6-7,12,15,17-18H2,1-2H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate?
2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate has a molecular weight of 490.56 g/mol, XLogP of 4.67, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-2-carboxylate is sourced from PubChem (CID 44764644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).