C20H22N2O4 — CID 2813431
ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-4-carboxylate (PubChem CID 2813431) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 2813431 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | ethyl 1-(2-phenoxypyridine-3-carbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cccnc2Oc2ccccc2)CC1 |
| InChI | InChI=1S/C20H22N2O4/c1-2-25-20(24)15-10-13-22(14-11-15)19(23)17-9-6-12-21-18(17)26-16-7-4-3-5-8-16/h3-9,12,15H,2,10-11,13-14H2,1H3 |
| InChIKey | UPCUTDNNXUIBAE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |