C17H24N2O3S — CID 44760758
ethyl 1-(2-propylsulfanylpyridine-3-carbonyl)piperidine-4-carboxylate (PubChem CID 44760758) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is ethyl 1-(2-propylsulfanylpyridine-3-carbonyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(2-propylsulfanylpyridine-3-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 44760758 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | ethyl 1-(2-propylsulfanylpyridine-3-carbonyl)piperidine-4-carboxylate |
| SMILES | CCCSc1ncccc1C(=O)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C17H24N2O3S/c1-3-12-23-15-14(6-5-9-18-15)16(20)19-10-7-13(8-11-19)17(21)22-4-2/h5-6,9,13H,3-4,7-8,10-12H2,1-2H3 |
| InChIKey | KYWYAXLIYRELTG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |