C14H16F2N2O3 — CID 105380316
ethyl 1-(2,3-difluoropyridine-4-carbonyl)piperidine-4-carboxylate (PubChem CID 105380316) has the molecular formula C14H16F2N2O3 and a molecular weight of 298.29 g/mol. Its IUPAC name is ethyl 1-(2,3-difluoropyridine-4-carbonyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(2,3-difluoropyridine-4-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 105380316 |
| Molecular Formula | C14H16F2N2O3 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | ethyl 1-(2,3-difluoropyridine-4-carbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccnc(F)c2F)CC1 |
| InChI | InChI=1S/C14H16F2N2O3/c1-2-21-14(20)9-4-7-18(8-5-9)13(19)10-3-6-17-12(16)11(10)15/h3,6,9H,2,4-5,7-8H2,1H3 |
| InChIKey | CSFIBSMLPVSQNE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|