C15H18F2N2O3S — CID 78806429
ethyl 1-[2-(difluoromethylsulfanyl)pyridine-3-carbonyl]piperidine-4-carboxylate (PubChem CID 78806429) has the molecular formula C15H18F2N2O3S and a molecular weight of 344.38 g/mol. Its IUPAC name is ethyl 1-[2-(difluoromethylsulfanyl)pyridine-3-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(difluoromethylsulfanyl)pyridine-3-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 78806429 |
| Molecular Formula | C15H18F2N2O3S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | ethyl 1-[2-(difluoromethylsulfanyl)pyridine-3-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cccnc2SC(F)F)CC1 |
| InChI | InChI=1S/C15H18F2N2O3S/c1-2-22-14(21)10-5-8-19(9-6-10)13(20)11-4-3-7-18-12(11)23-15(16)17/h3-4,7,10,15H,2,5-6,8-9H2,1H3 |
| InChIKey | XMJBMGDSTGXVJL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |