C22H22N2O3S — CID 78780461
ethyl 1-[2-(2-cyanophenyl)sulfanylbenzoyl]piperidine-4-carboxylate (PubChem CID 78780461) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is ethyl 1-[2-(2-cyanophenyl)sulfanylbenzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(2-cyanophenyl)sulfanylbenzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 78780461 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | ethyl 1-[2-(2-cyanophenyl)sulfanylbenzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccccc2Sc2ccccc2C#N)CC1 |
| InChI | InChI=1S/C22H22N2O3S/c1-2-27-22(26)16-11-13-24(14-12-16)21(25)18-8-4-6-10-20(18)28-19-9-5-3-7-17(19)15-23/h3-10,16H,2,11-14H2,1H3 |
| InChIKey | ZXWYURBPTREOTG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |