C10H10F2N2O — CID 105380117
(2,3-difluoro-4-pyridinyl)-pyrrolidin-1-ylmethanone (PubChem CID 105380117) has the molecular formula C10H10F2N2O and a molecular weight of 212.20 g/mol. Its IUPAC name is (2,3-difluoro-4-pyridinyl)-pyrrolidin-1-ylmethanone.
| Compound Name | (2,3-difluoro-4-pyridinyl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 105380117 |
| Molecular Formula | C10H10F2N2O |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (2,3-difluoro-4-pyridinyl)-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccnc(F)c1F)N1CCCC1 |
| InChI | InChI=1S/C10H10F2N2O/c11-8-7(3-4-13-9(8)12)10(15)14-5-1-2-6-14/h3-4H,1-2,5-6H2 |
| InChIKey | HPSGAQYIZOJWGL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|