C12H15F2N3O2 — CID 105380406
(2,3-difluoro-4-pyridinyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone (PubChem CID 105380406) has the molecular formula C12H15F2N3O2 and a molecular weight of 271.27 g/mol. Its IUPAC name is (2,3-difluoro-4-pyridinyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone.
| Compound Name | (2,3-difluoro-4-pyridinyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 105380406 |
| Molecular Formula | C12H15F2N3O2 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (2,3-difluoro-4-pyridinyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccnc(F)c1F)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C12H15F2N3O2/c13-10-9(1-2-15-11(10)14)12(19)17-5-3-16(4-6-17)7-8-18/h1-2,18H,3-8H2 |
| InChIKey | GRZROLSTGGIJBA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|