C13H20FN5O — CID 105387852
(3-fluoro-2-hydrazinyl-4-pyridinyl)-(4-propylpiperazin-1-yl)methanone (PubChem CID 105387852) has the molecular formula C13H20FN5O and a molecular weight of 281.33 g/mol. Its IUPAC name is (3-fluoro-2-hydrazinyl-4-pyridinyl)-(4-propylpiperazin-1-yl)methanone.
| Compound Name | (3-fluoro-2-hydrazinyl-4-pyridinyl)-(4-propylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 105387852 |
| Molecular Formula | C13H20FN5O |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | (3-fluoro-2-hydrazinyl-4-pyridinyl)-(4-propylpiperazin-1-yl)methanone |
| SMILES | CCCN1CCN(C(=O)c2ccnc(NN)c2F)CC1 |
| InChI | InChI=1S/C13H20FN5O/c1-2-5-18-6-8-19(9-7-18)13(20)10-3-4-16-12(17-15)11(10)14/h3-4H,2,5-9,15H2,1H3,(H,16,17) |
| InChIKey | LEZAZXIROVJBRM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|