C12H16FN5O2 — CID 105388347
3-ethyl-4-(3-fluoro-2-hydrazinylpyridine-4-carbonyl)piperazin-2-one (PubChem CID 105388347) has the molecular formula C12H16FN5O2 and a molecular weight of 281.29 g/mol. Its IUPAC name is 3-ethyl-4-(3-fluoro-2-hydrazinylpyridine-4-carbonyl)piperazin-2-one.
| Compound Name | 3-ethyl-4-(3-fluoro-2-hydrazinylpyridine-4-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 105388347 |
| Molecular Formula | C12H16FN5O2 |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3-ethyl-4-(3-fluoro-2-hydrazinylpyridine-4-carbonyl)piperazin-2-one |
| SMILES | CCC1C(=O)NCCN1C(=O)c1ccnc(NN)c1F |
| InChI | InChI=1S/C12H16FN5O2/c1-2-8-11(19)16-5-6-18(8)12(20)7-3-4-15-10(17-14)9(7)13/h3-4,8H,2,5-6,14H2,1H3,(H,15,17)(H,16,19) |
| InChIKey | YZLJFOMIIOVWSY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|