C13H19N5O2 — CID 81249127
3-ethyl-4-(4-hydrazinyl-6-methylpyridine-3-carbonyl)piperazin-2-one (PubChem CID 81249127) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 3-ethyl-4-(4-hydrazinyl-6-methylpyridine-3-carbonyl)piperazin-2-one.
| Compound Name | 3-ethyl-4-(4-hydrazinyl-6-methylpyridine-3-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 81249127 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3-ethyl-4-(4-hydrazinyl-6-methylpyridine-3-carbonyl)piperazin-2-one |
| SMILES | CCC1C(=O)NCCN1C(=O)c1cnc(C)cc1NN |
| InChI | InChI=1S/C13H19N5O2/c1-3-11-12(19)15-4-5-18(11)13(20)9-7-16-8(2)6-10(9)17-14/h6-7,11H,3-5,14H2,1-2H3,(H,15,19)(H,16,17) |
| InChIKey | IZGBPTIBRYVVAZ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|