C13H15ClN2O2S — CID 107029813
4-(2-chloro-5-sulfanylbenzoyl)-3-ethylpiperazin-2-one (PubChem CID 107029813) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is 4-(2-chloro-5-sulfanylbenzoyl)-3-ethylpiperazin-2-one.
| Compound Name | 4-(2-chloro-5-sulfanylbenzoyl)-3-ethylpiperazin-2-one |
|---|---|
| PubChem CID | 107029813 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 4-(2-chloro-5-sulfanylbenzoyl)-3-ethylpiperazin-2-one |
| SMILES | CCC1C(=O)NCCN1C(=O)c1cc(S)ccc1Cl |
| InChI | InChI=1S/C13H15ClN2O2S/c1-2-11-12(17)15-5-6-16(11)13(18)9-7-8(19)3-4-10(9)14/h3-4,7,11,19H,2,5-6H2,1H3,(H,15,17) |
| InChIKey | AFRZORNULSTWDY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|