C13H14I2N2O3 — CID 63601340
3-ethyl-4-(2-hydroxy-3,5-diiodobenzoyl)piperazin-2-one (PubChem CID 63601340) has the molecular formula C13H14I2N2O3 and a molecular weight of 500.07 g/mol. Its IUPAC name is 3-ethyl-4-(2-hydroxy-3,5-diiodobenzoyl)piperazin-2-one.
| Compound Name | 3-ethyl-4-(2-hydroxy-3,5-diiodobenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 63601340 |
| Molecular Formula | C13H14I2N2O3 |
| Molecular Weight | 500.07 g/mol |
| Exact Mass | 499.91 |
| IUPAC Name | 3-ethyl-4-(2-hydroxy-3,5-diiodobenzoyl)piperazin-2-one |
| SMILES | CCC1C(=O)NCCN1C(=O)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C13H14I2N2O3/c1-2-10-12(19)16-3-4-17(10)13(20)8-5-7(14)6-9(15)11(8)18/h5-6,10,18H,2-4H2,1H3,(H,16,19) |
| InChIKey | URSQANGWLSFDNS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.07 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|