C14H17IN2O2 — CID 1382904
(3R)-3-ethyl-4-(3-iodo-4-methylbenzoyl)piperazin-2-one (PubChem CID 1382904) has the molecular formula C14H17IN2O2 and a molecular weight of 372.21 g/mol. Its IUPAC name is (3R)-3-ethyl-4-(3-iodo-4-methylbenzoyl)piperazin-2-one.
| Compound Name | (3R)-3-ethyl-4-(3-iodo-4-methylbenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 1382904 |
| Molecular Formula | C14H17IN2O2 |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | (3R)-3-ethyl-4-(3-iodo-4-methylbenzoyl)piperazin-2-one |
| SMILES | CC[C@@H]1C(=O)NCCN1C(=O)c1ccc(C)c(I)c1 |
| InChI | InChI=1S/C14H17IN2O2/c1-3-12-13(18)16-6-7-17(12)14(19)10-5-4-9(2)11(15)8-10/h4-5,8,12H,3,6-7H2,1-2H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | WKRAFSZVSCJPFV-GFCCVEGCSA-N |
| XLogP | 1.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|