C13H17N3O3 — CID 55217695
3-ethyl-4-(1-methyl-2-oxopyridine-4-carbonyl)piperazin-2-one (PubChem CID 55217695) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-ethyl-4-(1-methyl-2-oxopyridine-4-carbonyl)piperazin-2-one.
| Compound Name | 3-ethyl-4-(1-methyl-2-oxopyridine-4-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 55217695 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-ethyl-4-(1-methyl-2-oxopyridine-4-carbonyl)piperazin-2-one |
| SMILES | CCC1C(=O)NCCN1C(=O)c1ccn(C)c(=O)c1 |
| InChI | InChI=1S/C13H17N3O3/c1-3-10-12(18)14-5-7-16(10)13(19)9-4-6-15(2)11(17)8-9/h4,6,8,10H,3,5,7H2,1-2H3,(H,14,18) |
| InChIKey | WUHVNWRYPHOJBG-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |