C24H35IN2O4 — CID 17093894
decyl 2-[1-(3-iodo-4-methylbenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 17093894) has the molecular formula C24H35IN2O4 and a molecular weight of 542.46 g/mol. Its IUPAC name is decyl 2-[1-(3-iodo-4-methylbenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-(3-iodo-4-methylbenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17093894 |
| Molecular Formula | C24H35IN2O4 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | decyl 2-[1-(3-iodo-4-methylbenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=O)c1ccc(C)c(I)c1 |
| InChI | InChI=1S/C24H35IN2O4/c1-3-4-5-6-7-8-9-10-15-31-22(28)17-21-23(29)26-13-14-27(21)24(30)19-12-11-18(2)20(25)16-19/h11-12,16,21H,3-10,13-15,17H2,1-2H3,(H,26,29) |
| InChIKey | LWZJDVSABNMLQX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|