C28H36N2O5 — CID 4950718
2-phenylethyl 2-[1-(4-heptoxybenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 4950718) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-phenylethyl 2-[1-(4-heptoxybenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-phenylethyl 2-[1-(4-heptoxybenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4950718 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 2-phenylethyl 2-[1-(4-heptoxybenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCOc1ccc(C(=O)N2CCNC(=O)C2CC(=O)OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H36N2O5/c1-2-3-4-5-9-19-34-24-14-12-23(13-15-24)28(33)30-18-17-29-27(32)25(30)21-26(31)35-20-16-22-10-7-6-8-11-22/h6-8,10-15,25H,2-5,9,16-21H2,1H3,(H,29,32) |
| InChIKey | SMXFXAPHHLZVAT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|