C25H30N2O6 — CID 4956556
2-phenoxyethyl 2-[1-(3-butoxybenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 4956556) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 2-phenoxyethyl 2-[1-(3-butoxybenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-phenoxyethyl 2-[1-(3-butoxybenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4956556 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 2-phenoxyethyl 2-[1-(3-butoxybenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOc1cccc(C(=O)N2CCNC(=O)C2CC(=O)OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C25H30N2O6/c1-2-3-14-31-21-11-7-8-19(17-21)25(30)27-13-12-26-24(29)22(27)18-23(28)33-16-15-32-20-9-5-4-6-10-20/h4-11,17,22H,2-3,12-16,18H2,1H3,(H,26,29) |
| InChIKey | WSKPHQIXDLEGMB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|