C26H32N2O5 — CID 4981763
2-phenylethyl 2-[1-[3-(3-methylbutoxy)benzoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4981763) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is 2-phenylethyl 2-[1-[3-(3-methylbutoxy)benzoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-phenylethyl 2-[1-[3-(3-methylbutoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4981763 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-phenylethyl 2-[1-[3-(3-methylbutoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CC(C)CCOc1cccc(C(=O)N2CCNC(=O)C2CC(=O)OCCc2ccccc2)c1 |
| InChI | InChI=1S/C26H32N2O5/c1-19(2)11-15-32-22-10-6-9-21(17-22)26(31)28-14-13-27-25(30)23(28)18-24(29)33-16-12-20-7-4-3-5-8-20/h3-10,17,19,23H,11-16,18H2,1-2H3,(H,27,30) |
| InChIKey | WABLTENOAOZZEG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |