C25H30N2O5 — CID 17079792
3-methylbutyl 2-[3-oxo-1-(2-phenylmethoxybenzoyl)piperazin-2-yl]acetate (PubChem CID 17079792) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is 3-methylbutyl 2-[3-oxo-1-(2-phenylmethoxybenzoyl)piperazin-2-yl]acetate.
| Compound Name | 3-methylbutyl 2-[3-oxo-1-(2-phenylmethoxybenzoyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17079792 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 3-methylbutyl 2-[3-oxo-1-(2-phenylmethoxybenzoyl)piperazin-2-yl]acetate |
| SMILES | CC(C)CCOC(=O)CC1C(=O)NCCN1C(=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H30N2O5/c1-18(2)12-15-31-23(28)16-21-24(29)26-13-14-27(21)25(30)20-10-6-7-11-22(20)32-17-19-8-4-3-5-9-19/h3-11,18,21H,12-17H2,1-2H3,(H,26,29) |
| InChIKey | CGUUEUGJOUGIBX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |