C24H28N2O5 — CID 4945449
benzyl 2-[1-[2-(2-methylpropoxy)benzoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4945449) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is benzyl 2-[1-[2-(2-methylpropoxy)benzoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | benzyl 2-[1-[2-(2-methylpropoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4945449 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | benzyl 2-[1-[2-(2-methylpropoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CC(C)COc1ccccc1C(=O)N1CCNC(=O)C1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H28N2O5/c1-17(2)15-30-21-11-7-6-10-19(21)24(29)26-13-12-25-23(28)20(26)14-22(27)31-16-18-8-4-3-5-9-18/h3-11,17,20H,12-16H2,1-2H3,(H,25,28) |
| InChIKey | SLENDLCCLWHIQJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |