C16H19N3O4S — CID 4927877
benzyl 2-[1-(acetylcarbamothioyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 4927877) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is benzyl 2-[1-(acetylcarbamothioyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | benzyl 2-[1-(acetylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4927877 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | benzyl 2-[1-(acetylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CC(=O)NC(=S)N1CCNC(=O)C1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19N3O4S/c1-11(20)18-16(24)19-8-7-17-15(22)13(19)9-14(21)23-10-12-5-3-2-4-6-12/h2-6,13H,7-10H2,1H3,(H,17,22)(H,18,20,24) |
| InChIKey | AGKUMRGEXKIKLT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|