C24H25N3O5S — CID 4927875
benzyl 2-[1-[3-(2-methoxyphenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4927875) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is benzyl 2-[1-[3-(2-methoxyphenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | benzyl 2-[1-[3-(2-methoxyphenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4927875 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | benzyl 2-[1-[3-(2-methoxyphenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COc1ccccc1C=CC(=O)NC(=S)N1CCNC(=O)C1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-31-20-10-6-5-9-18(20)11-12-21(28)26-24(33)27-14-13-25-23(30)19(27)15-22(29)32-16-17-7-3-2-4-8-17/h2-12,19H,13-16H2,1H3,(H,25,30)(H,26,28,33) |
| InChIKey | KJZJMEYULDFVET-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|